C14H20BrN3OS — CID 106482169
5-bromo-6-cyclopentyl-2-(4-methylmorpholin-2-yl)-1H-pyrimidine-4-thione (PubChem CID 106482169) has the molecular formula C14H20BrN3OS and a molecular weight of 358.31 g/mol. Its IUPAC name is 5-bromo-6-cyclopentyl-2-(4-methylmorpholin-2-yl)-1H-pyrimidine-4-thione.
| Compound Name | 5-bromo-6-cyclopentyl-2-(4-methylmorpholin-2-yl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106482169 |
| Molecular Formula | C14H20BrN3OS |
| Molecular Weight | 358.31 g/mol |
| Exact Mass | 357.05 |
| IUPAC Name | 5-bromo-6-cyclopentyl-2-(4-methylmorpholin-2-yl)-1H-pyrimidine-4-thione |
| SMILES | CN1CCOC(c2nc(=S)c(Br)c(C3CCCC3)[nH]2)C1 |
| InChI | InChI=1S/C14H20BrN3OS/c1-18-6-7-19-10(8-18)13-16-12(9-4-2-3-5-9)11(15)14(20)17-13/h9-10H,2-8H2,1H3,(H,16,17,20) |
| InChIKey | PVLKUGABQLDWGN-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 41.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.31 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|