C16H24N2O2S — CID 106482436
2-[cyclohexyl(ethoxy)methyl]-1,5,7,8-tetrahydropyrano[4,3-d]pyrimidine-4-thione (PubChem CID 106482436) has the molecular formula C16H24N2O2S and a molecular weight of 308.45 g/mol. Its IUPAC name is 2-[cyclohexyl(ethoxy)methyl]-1,5,7,8-tetrahydropyrano[4,3-d]pyrimidine-4-thione.
| Compound Name | 2-[cyclohexyl(ethoxy)methyl]-1,5,7,8-tetrahydropyrano[4,3-d]pyrimidine-4-thione |
|---|---|
| PubChem CID | 106482436 |
| Molecular Formula | C16H24N2O2S |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 2-[cyclohexyl(ethoxy)methyl]-1,5,7,8-tetrahydropyrano[4,3-d]pyrimidine-4-thione |
| SMILES | CCOC(c1nc(=S)c2c([nH]1)CCOC2)C1CCCCC1 |
| InChI | InChI=1S/C16H24N2O2S/c1-2-20-14(11-6-4-3-5-7-11)15-17-13-8-9-19-10-12(13)16(21)18-15/h11,14H,2-10H2,1H3,(H,17,18,21) |
| InChIKey | KRKONKUPLMNEHI-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|