C17H25NO3 — CID 106484006
benzyl 3-[(2-hydroxycyclohexyl)amino]-2-methylpropanoate (PubChem CID 106484006) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is benzyl 3-[(2-hydroxycyclohexyl)amino]-2-methylpropanoate.
| Compound Name | benzyl 3-[(2-hydroxycyclohexyl)amino]-2-methylpropanoate |
|---|---|
| PubChem CID | 106484006 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | benzyl 3-[(2-hydroxycyclohexyl)amino]-2-methylpropanoate |
| SMILES | CC(CNC1CCCCC1O)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H25NO3/c1-13(11-18-15-9-5-6-10-16(15)19)17(20)21-12-14-7-3-2-4-8-14/h2-4,7-8,13,15-16,18-19H,5-6,9-12H2,1H3 |
| InChIKey | FYDKEKYWEKVUEQ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |