C24H51NO5Si2 — CID 10648746
tert-butyl (2R)-2-[(1S)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]ethyl]-5-methoxypyrrolidine-1-carboxylate (PubChem CID 10648746) has the molecular formula C24H51NO5Si2 and a molecular weight of 489.85 g/mol. Its IUPAC name is tert-butyl (2R)-2-[(1S)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]ethyl]-5-methoxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-[(1S)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]ethyl]-5-methoxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 10648746 |
| Molecular Formula | C24H51NO5Si2 |
| Molecular Weight | 489.85 g/mol |
| Exact Mass | 489.33 |
| IUPAC Name | tert-butyl (2R)-2-[(1S)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]ethyl]-5-methoxypyrrolidine-1-carboxylate |
| SMILES | COC1CC[C@H]([C@@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H51NO5Si2/c1-22(2,3)29-21(26)25-18(15-16-20(25)27-10)19(30-32(13,14)24(7,8)9)17-28-31(11,12)23(4,5)6/h18-20H,15-17H2,1-14H3/t18-,19-,20?/m1/s1 |
| InChIKey | UKDZGIQXJRMRQU-LEAGNCFPSA-N |
| XLogP | 6.77 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.85 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|