C32H24N6 — CID 10648840
(E)-1-(1,3-diphenylpyrazol-4-yl)-N-[(E)-(1,3-diphenylpyrazol-4-yl)methylideneamino]methanimine (PubChem CID 10648840) has the molecular formula C32H24N6 and a molecular weight of 492.59 g/mol. Its IUPAC name is (E)-1-(1,3-diphenylpyrazol-4-yl)-N-[(E)-(1,3-diphenylpyrazol-4-yl)methylideneamino]methanimine.
| Compound Name | (E)-1-(1,3-diphenylpyrazol-4-yl)-N-[(E)-(1,3-diphenylpyrazol-4-yl)methylideneamino]methanimine |
|---|---|
| PubChem CID | 10648840 |
| Molecular Formula | C32H24N6 |
| Molecular Weight | 492.59 g/mol |
| Exact Mass | 492.21 |
| IUPAC Name | (E)-1-(1,3-diphenylpyrazol-4-yl)-N-[(E)-(1,3-diphenylpyrazol-4-yl)methylideneamino]methanimine |
| SMILES | C(=N/N=C/c1cn(-c2ccccc2)nc1-c1ccccc1)\c1cn(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C32H24N6/c1-5-13-25(14-6-1)31-27(23-37(35-31)29-17-9-3-10-18-29)21-33-34-22-28-24-38(30-19-11-4-12-20-30)36-32(28)26-15-7-2-8-16-26/h1-24H/b33-21+,34-22+ |
| InChIKey | LQPZCMWHJHSCFZ-WXGDAXOSSA-N |
| XLogP | 6.84 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.59 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|