C11H23NO2 — CID 106489127
2-(aminomethyl)-3-methyl-2-(2-methylpropyl)pentanoic acid (PubChem CID 106489127) has the molecular formula C11H23NO2 and a molecular weight of 201.31 g/mol. Its IUPAC name is 2-(aminomethyl)-3-methyl-2-(2-methylpropyl)pentanoic acid.
| Compound Name | 2-(aminomethyl)-3-methyl-2-(2-methylpropyl)pentanoic acid |
|---|---|
| PubChem CID | 106489127 |
| Molecular Formula | C11H23NO2 |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.17 |
| IUPAC Name | 2-(aminomethyl)-3-methyl-2-(2-methylpropyl)pentanoic acid |
| SMILES | CCC(C)C(CN)(CC(C)C)C(=O)O |
| InChI | InChI=1S/C11H23NO2/c1-5-9(4)11(7-12,10(13)14)6-8(2)3/h8-9H,5-7,12H2,1-4H3,(H,13,14) |
| InChIKey | MIMRUKLALKEXDO-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |