C12H25NO2 — CID 106488970
2-(aminomethyl)-3-ethyl-2-(2-methylpropyl)pentanoic acid (PubChem CID 106488970) has the molecular formula C12H25NO2 and a molecular weight of 215.34 g/mol. Its IUPAC name is 2-(aminomethyl)-3-ethyl-2-(2-methylpropyl)pentanoic acid.
| Compound Name | 2-(aminomethyl)-3-ethyl-2-(2-methylpropyl)pentanoic acid |
|---|---|
| PubChem CID | 106488970 |
| Molecular Formula | C12H25NO2 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.19 |
| IUPAC Name | 2-(aminomethyl)-3-ethyl-2-(2-methylpropyl)pentanoic acid |
| SMILES | CCC(CC)C(CN)(CC(C)C)C(=O)O |
| InChI | InChI=1S/C12H25NO2/c1-5-10(6-2)12(8-13,11(14)15)7-9(3)4/h9-10H,5-8,13H2,1-4H3,(H,14,15) |
| InChIKey | HRYMVDZQYBQUOJ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |