About 2-(aminomethyl)-5,5,5-trifluoro-2-propan-2-ylpentanoic acid
2-(aminomethyl)-5,5,5-trifluoro-2-propan-2-ylpentanoic acid (PubChem CID 106488526) has the molecular formula C9H16F3NO2
and a molecular weight of 227.23 g/mol. Its IUPAC name is 2-(aminomethyl)-5,5,5-trifluoro-2-propan-2-ylpentanoic acid.
Analyze 2-(aminomethyl)-5,5,5-trifluoro-2-propan-2-ylpentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(aminomethyl)-5,5,5-trifluoro-2-propan-2-ylpentanoic acid?
The IUPAC name of 2-(aminomethyl)-5,5,5-trifluoro-2-propan-2-ylpentanoic acid (CID 106488526) is 2-(aminomethyl)-5,5,5-trifluoro-2-propan-2-ylpentanoic acid.
What is the SMILES notation for 2-(aminomethyl)-5,5,5-trifluoro-2-propan-2-ylpentanoic acid?
The canonical SMILES for 2-(aminomethyl)-5,5,5-trifluoro-2-propan-2-ylpentanoic acid is CC(C)C(CN)(CCC(F)(F)F)C(=O)O.
What is the InChIKey of 2-(aminomethyl)-5,5,5-trifluoro-2-propan-2-ylpentanoic acid?
The InChIKey is JEMVEIXYFYPIAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16F3NO2/c1-6(2)8(5-13,7(14)15)3-4-9(10,11)12/h6H,3-5,13H2,1-2H3,(H,14,15).
What are the key properties of 2-(aminomethyl)-5,5,5-trifluoro-2-propan-2-ylpentanoic acid?
2-(aminomethyl)-5,5,5-trifluoro-2-propan-2-ylpentanoic acid has a molecular weight of 227.23 g/mol, XLogP of 2.01, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(aminomethyl)-5,5,5-trifluoro-2-propan-2-ylpentanoic acid is sourced from PubChem (CID 106488526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).