C9H16F3NO3 — CID 106488477
2-(aminomethyl)-3-methyl-2-[2-(trifluoromethoxy)ethyl]butanoic acid (PubChem CID 106488477) has the molecular formula C9H16F3NO3 and a molecular weight of 243.22 g/mol. Its IUPAC name is 2-(aminomethyl)-3-methyl-2-[2-(trifluoromethoxy)ethyl]butanoic acid.
| Compound Name | 2-(aminomethyl)-3-methyl-2-[2-(trifluoromethoxy)ethyl]butanoic acid |
|---|---|
| PubChem CID | 106488477 |
| Molecular Formula | C9H16F3NO3 |
| Molecular Weight | 243.22 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | 2-(aminomethyl)-3-methyl-2-[2-(trifluoromethoxy)ethyl]butanoic acid |
| SMILES | CC(C)C(CN)(CCOC(F)(F)F)C(=O)O |
| InChI | InChI=1S/C9H16F3NO3/c1-6(2)8(5-13,7(14)15)3-4-16-9(10,11)12/h6H,3-5,13H2,1-2H3,(H,14,15) |
| InChIKey | WCSSIPVJBRTOBZ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.22 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |