C11H23NO4S — CID 106489134
2-(aminomethyl)-2-(2-ethylsulfonylethyl)-4-methylpentanoic acid (PubChem CID 106489134) has the molecular formula C11H23NO4S and a molecular weight of 265.37 g/mol. Its IUPAC name is 2-(aminomethyl)-2-(2-ethylsulfonylethyl)-4-methylpentanoic acid.
| Compound Name | 2-(aminomethyl)-2-(2-ethylsulfonylethyl)-4-methylpentanoic acid |
|---|---|
| PubChem CID | 106489134 |
| Molecular Formula | C11H23NO4S |
| Molecular Weight | 265.37 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 2-(aminomethyl)-2-(2-ethylsulfonylethyl)-4-methylpentanoic acid |
| SMILES | CCS(=O)(=O)CCC(CN)(CC(C)C)C(=O)O |
| InChI | InChI=1S/C11H23NO4S/c1-4-17(15,16)6-5-11(8-12,10(13)14)7-9(2)3/h9H,4-8,12H2,1-3H3,(H,13,14) |
| InChIKey | NRFMVSGGBHYCSP-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.37 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |