C15H20FNO3 — CID 106490199
2-(aminomethyl)-2-(cyclopropylmethyl)-3-(3-fluoro-4-methoxyphenyl)propanoic acid (PubChem CID 106490199) has the molecular formula C15H20FNO3 and a molecular weight of 281.33 g/mol. Its IUPAC name is 2-(aminomethyl)-2-(cyclopropylmethyl)-3-(3-fluoro-4-methoxyphenyl)propanoic acid.
| Compound Name | 2-(aminomethyl)-2-(cyclopropylmethyl)-3-(3-fluoro-4-methoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 106490199 |
| Molecular Formula | C15H20FNO3 |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 2-(aminomethyl)-2-(cyclopropylmethyl)-3-(3-fluoro-4-methoxyphenyl)propanoic acid |
| SMILES | COc1ccc(CC(CN)(CC2CC2)C(=O)O)cc1F |
| InChI | InChI=1S/C15H20FNO3/c1-20-13-5-4-11(6-12(13)16)8-15(9-17,14(18)19)7-10-2-3-10/h4-6,10H,2-3,7-9,17H2,1H3,(H,18,19) |
| InChIKey | KNJCXFMTDGLLFR-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |