C16H24FNO2 — CID 106490548
ethyl 2-(aminomethyl)-2-(2-fluorophenyl)-4-methylhexanoate (PubChem CID 106490548) has the molecular formula C16H24FNO2 and a molecular weight of 281.37 g/mol. Its IUPAC name is ethyl 2-(aminomethyl)-2-(2-fluorophenyl)-4-methylhexanoate.
| Compound Name | ethyl 2-(aminomethyl)-2-(2-fluorophenyl)-4-methylhexanoate |
|---|---|
| PubChem CID | 106490548 |
| Molecular Formula | C16H24FNO2 |
| Molecular Weight | 281.37 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | ethyl 2-(aminomethyl)-2-(2-fluorophenyl)-4-methylhexanoate |
| SMILES | CCOC(=O)C(CN)(CC(C)CC)c1ccccc1F |
| InChI | InChI=1S/C16H24FNO2/c1-4-12(3)10-16(11-18,15(19)20-5-2)13-8-6-7-9-14(13)17/h6-9,12H,4-5,10-11,18H2,1-3H3 |
| InChIKey | ZBRIQEJKRXFQQL-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.37 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |