C17H26FNO2 — CID 106490514
ethyl 2-(aminomethyl)-2-(2-fluorophenyl)-5,5-dimethylhexanoate (PubChem CID 106490514) has the molecular formula C17H26FNO2 and a molecular weight of 295.40 g/mol. Its IUPAC name is ethyl 2-(aminomethyl)-2-(2-fluorophenyl)-5,5-dimethylhexanoate.
| Compound Name | ethyl 2-(aminomethyl)-2-(2-fluorophenyl)-5,5-dimethylhexanoate |
|---|---|
| PubChem CID | 106490514 |
| Molecular Formula | C17H26FNO2 |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | ethyl 2-(aminomethyl)-2-(2-fluorophenyl)-5,5-dimethylhexanoate |
| SMILES | CCOC(=O)C(CN)(CCC(C)(C)C)c1ccccc1F |
| InChI | InChI=1S/C17H26FNO2/c1-5-21-15(20)17(12-19,11-10-16(2,3)4)13-8-6-7-9-14(13)18/h6-9H,5,10-12,19H2,1-4H3 |
| InChIKey | CUNBGGUNGARRRI-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |