C16H17FN2O2 — CID 106490629
2-(aminomethyl)-2-(2-fluorophenyl)-4-pyridin-2-ylbutanoic acid (PubChem CID 106490629) has the molecular formula C16H17FN2O2 and a molecular weight of 288.32 g/mol. Its IUPAC name is 2-(aminomethyl)-2-(2-fluorophenyl)-4-pyridin-2-ylbutanoic acid.
| Compound Name | 2-(aminomethyl)-2-(2-fluorophenyl)-4-pyridin-2-ylbutanoic acid |
|---|---|
| PubChem CID | 106490629 |
| Molecular Formula | C16H17FN2O2 |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 2-(aminomethyl)-2-(2-fluorophenyl)-4-pyridin-2-ylbutanoic acid |
| SMILES | NCC(CCc1ccccn1)(C(=O)O)c1ccccc1F |
| InChI | InChI=1S/C16H17FN2O2/c17-14-7-2-1-6-13(14)16(11-18,15(20)21)9-8-12-5-3-4-10-19-12/h1-7,10H,8-9,11,18H2,(H,20,21) |
| InChIKey | WXPGWQJUBOHDIA-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |