C13H18FNO3 — CID 106490862
methyl 2-(aminomethyl)-2-(4-fluorophenyl)-4-hydroxypentanoate (PubChem CID 106490862) has the molecular formula C13H18FNO3 and a molecular weight of 255.29 g/mol. Its IUPAC name is methyl 2-(aminomethyl)-2-(4-fluorophenyl)-4-hydroxypentanoate.
| Compound Name | methyl 2-(aminomethyl)-2-(4-fluorophenyl)-4-hydroxypentanoate |
|---|---|
| PubChem CID | 106490862 |
| Molecular Formula | C13H18FNO3 |
| Molecular Weight | 255.29 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | methyl 2-(aminomethyl)-2-(4-fluorophenyl)-4-hydroxypentanoate |
| SMILES | COC(=O)C(CN)(CC(C)O)c1ccc(F)cc1 |
| InChI | InChI=1S/C13H18FNO3/c1-9(16)7-13(8-15,12(17)18-2)10-3-5-11(14)6-4-10/h3-6,9,16H,7-8,15H2,1-2H3 |
| InChIKey | AVEBNVRIEMZXGP-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.29 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |