C15H22FNO3 — CID 106490863
methyl 2-(aminomethyl)-2-(4-fluorophenyl)-5-hydroxy-5-methylhexanoate (PubChem CID 106490863) has the molecular formula C15H22FNO3 and a molecular weight of 283.34 g/mol. Its IUPAC name is methyl 2-(aminomethyl)-2-(4-fluorophenyl)-5-hydroxy-5-methylhexanoate.
| Compound Name | methyl 2-(aminomethyl)-2-(4-fluorophenyl)-5-hydroxy-5-methylhexanoate |
|---|---|
| PubChem CID | 106490863 |
| Molecular Formula | C15H22FNO3 |
| Molecular Weight | 283.34 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | methyl 2-(aminomethyl)-2-(4-fluorophenyl)-5-hydroxy-5-methylhexanoate |
| SMILES | COC(=O)C(CN)(CCC(C)(C)O)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H22FNO3/c1-14(2,19)8-9-15(10-17,13(18)20-3)11-4-6-12(16)7-5-11/h4-7,19H,8-10,17H2,1-3H3 |
| InChIKey | BFJSRTFOEFAIDN-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.34 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |