C13H18FNO4S — CID 106490929
2-(aminomethyl)-2-(4-fluorophenyl)-5-methylsulfonylpentanoic acid (PubChem CID 106490929) has the molecular formula C13H18FNO4S and a molecular weight of 303.35 g/mol. Its IUPAC name is 2-(aminomethyl)-2-(4-fluorophenyl)-5-methylsulfonylpentanoic acid.
| Compound Name | 2-(aminomethyl)-2-(4-fluorophenyl)-5-methylsulfonylpentanoic acid |
|---|---|
| PubChem CID | 106490929 |
| Molecular Formula | C13H18FNO4S |
| Molecular Weight | 303.35 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 2-(aminomethyl)-2-(4-fluorophenyl)-5-methylsulfonylpentanoic acid |
| SMILES | CS(=O)(=O)CCCC(CN)(C(=O)O)c1ccc(F)cc1 |
| InChI | InChI=1S/C13H18FNO4S/c1-20(18,19)8-2-7-13(9-15,12(16)17)10-3-5-11(14)6-4-10/h3-6H,2,7-9,15H2,1H3,(H,16,17) |
| InChIKey | UDDBLSGZCXAWJG-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.35 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |