C13H19NO3 — CID 106509245
2-(aminomethyl)-5-hydroxy-2-(4-methylphenyl)pentanoic acid (PubChem CID 106509245) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is 2-(aminomethyl)-5-hydroxy-2-(4-methylphenyl)pentanoic acid.
| Compound Name | 2-(aminomethyl)-5-hydroxy-2-(4-methylphenyl)pentanoic acid |
|---|---|
| PubChem CID | 106509245 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | 2-(aminomethyl)-5-hydroxy-2-(4-methylphenyl)pentanoic acid |
| SMILES | Cc1ccc(C(CN)(CCCO)C(=O)O)cc1 |
| InChI | InChI=1S/C13H19NO3/c1-10-3-5-11(6-4-10)13(9-14,12(16)17)7-2-8-15/h3-6,15H,2,7-9,14H2,1H3,(H,16,17) |
| InChIKey | SKODXBZFKKBBMC-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |