C13H13BrFN3O2S — CID 106491482
2-amino-5-bromo-4-fluoro-N-(2-pyridin-3-ylethyl)benzenesulfonamide (PubChem CID 106491482) has the molecular formula C13H13BrFN3O2S and a molecular weight of 374.24 g/mol. Its IUPAC name is 2-amino-5-bromo-4-fluoro-N-(2-pyridin-3-ylethyl)benzenesulfonamide.
| Compound Name | 2-amino-5-bromo-4-fluoro-N-(2-pyridin-3-ylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106491482 |
| Molecular Formula | C13H13BrFN3O2S |
| Molecular Weight | 374.24 g/mol |
| Exact Mass | 372.99 |
| IUPAC Name | 2-amino-5-bromo-4-fluoro-N-(2-pyridin-3-ylethyl)benzenesulfonamide |
| SMILES | Nc1cc(F)c(Br)cc1S(=O)(=O)NCCc1cccnc1 |
| InChI | InChI=1S/C13H13BrFN3O2S/c14-10-6-13(12(16)7-11(10)15)21(19,20)18-5-3-9-2-1-4-17-8-9/h1-2,4,6-8,18H,3,5,16H2 |
| InChIKey | ATNYQXIURNWKFQ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.24 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|