C13H20F2N2O2 — CID 106492809
5-[(1,2,3,5,6,7,8,8a-octahydroindolizin-7-ylamino)methyl]-3,3-difluorooxolan-2-one (PubChem CID 106492809) has the molecular formula C13H20F2N2O2 and a molecular weight of 274.31 g/mol. Its IUPAC name is 5-[(1,2,3,5,6,7,8,8a-octahydroindolizin-7-ylamino)methyl]-3,3-difluorooxolan-2-one.
| Compound Name | 5-[(1,2,3,5,6,7,8,8a-octahydroindolizin-7-ylamino)methyl]-3,3-difluorooxolan-2-one |
|---|---|
| PubChem CID | 106492809 |
| Molecular Formula | C13H20F2N2O2 |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | 5-[(1,2,3,5,6,7,8,8a-octahydroindolizin-7-ylamino)methyl]-3,3-difluorooxolan-2-one |
| SMILES | O=C1OC(CNC2CCN3CCCC3C2)CC1(F)F |
| InChI | InChI=1S/C13H20F2N2O2/c14-13(15)7-11(19-12(13)18)8-16-9-3-5-17-4-1-2-10(17)6-9/h9-11,16H,1-8H2 |
| InChIKey | FFPFISFXLFJRFD-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |