About 2-[(4,4-difluoro-5-oxooxolan-2-yl)methylamino]oxyacetamide
2-[(4,4-difluoro-5-oxooxolan-2-yl)methylamino]oxyacetamide (PubChem CID 106492855) has the molecular formula C7H10F2N2O4
and a molecular weight of 224.16 g/mol. Its IUPAC name is 2-[(4,4-difluoro-5-oxooxolan-2-yl)methylamino]oxyacetamide.
Molecular Properties
| Compound Name | 2-[(4,4-difluoro-5-oxooxolan-2-yl)methylamino]oxyacetamide |
| PubChem CID | 106492855 |
| Molecular Formula | C7H10F2N2O4 |
| Molecular Weight | 224.16 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | 2-[(4,4-difluoro-5-oxooxolan-2-yl)methylamino]oxyacetamide |
| SMILES | NC(=O)CONCC1CC(F)(F)C(=O)O1 |
| InChI | InChI=1S/C7H10F2N2O4/c8-7(9)1-4(15-6(7)13)2-11-14-3-5(10)12/h4,11H,1-3H2,(H2,10,12) |
| InChIKey | BFTIOMWKOGWTHT-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.16 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[(4,4-difluoro-5-oxooxolan-2-yl)methylamino]oxyacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4,4-difluoro-5-oxooxolan-2-yl)methylamino]oxyacetamide?
The IUPAC name of 2-[(4,4-difluoro-5-oxooxolan-2-yl)methylamino]oxyacetamide (CID 106492855) is 2-[(4,4-difluoro-5-oxooxolan-2-yl)methylamino]oxyacetamide.
What is the SMILES notation for 2-[(4,4-difluoro-5-oxooxolan-2-yl)methylamino]oxyacetamide?
The canonical SMILES for 2-[(4,4-difluoro-5-oxooxolan-2-yl)methylamino]oxyacetamide is NC(=O)CONCC1CC(F)(F)C(=O)O1.
What is the InChIKey of 2-[(4,4-difluoro-5-oxooxolan-2-yl)methylamino]oxyacetamide?
The InChIKey is BFTIOMWKOGWTHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10F2N2O4/c8-7(9)1-4(15-6(7)13)2-11-14-3-5(10)12/h4,11H,1-3H2,(H2,10,12).
What are the key properties of 2-[(4,4-difluoro-5-oxooxolan-2-yl)methylamino]oxyacetamide?
2-[(4,4-difluoro-5-oxooxolan-2-yl)methylamino]oxyacetamide has a molecular weight of 224.16 g/mol, XLogP of -1.06, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4,4-difluoro-5-oxooxolan-2-yl)methylamino]oxyacetamide is sourced from PubChem (CID 106492855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).