C10H19BrO3S — CID 106493735
2-[(3-bromo-2,2-dimethylpropyl)sulfonylmethyl]oxolane (PubChem CID 106493735) has the molecular formula C10H19BrO3S and a molecular weight of 299.23 g/mol. Its IUPAC name is 2-[(3-bromo-2,2-dimethylpropyl)sulfonylmethyl]oxolane.
| Compound Name | 2-[(3-bromo-2,2-dimethylpropyl)sulfonylmethyl]oxolane |
|---|---|
| PubChem CID | 106493735 |
| Molecular Formula | C10H19BrO3S |
| Molecular Weight | 299.23 g/mol |
| Exact Mass | 298.02 |
| IUPAC Name | 2-[(3-bromo-2,2-dimethylpropyl)sulfonylmethyl]oxolane |
| SMILES | CC(C)(CBr)CS(=O)(=O)CC1CCCO1 |
| InChI | InChI=1S/C10H19BrO3S/c1-10(2,7-11)8-15(12,13)6-9-4-3-5-14-9/h9H,3-8H2,1-2H3 |
| InChIKey | ZXFPLFAQLITLKI-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.23 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|