C11H14ClFN2OS — CID 106494052
4-chloro-5-fluoro-6-(oxolan-2-ylmethylsulfanyl)benzene-1,3-diamine (PubChem CID 106494052) has the molecular formula C11H14ClFN2OS and a molecular weight of 276.76 g/mol. Its IUPAC name is 4-chloro-5-fluoro-6-(oxolan-2-ylmethylsulfanyl)benzene-1,3-diamine.
| Compound Name | 4-chloro-5-fluoro-6-(oxolan-2-ylmethylsulfanyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 106494052 |
| Molecular Formula | C11H14ClFN2OS |
| Molecular Weight | 276.76 g/mol |
| Exact Mass | 276.05 |
| IUPAC Name | 4-chloro-5-fluoro-6-(oxolan-2-ylmethylsulfanyl)benzene-1,3-diamine |
| SMILES | Nc1cc(N)c(SCC2CCCO2)c(F)c1Cl |
| InChI | InChI=1S/C11H14ClFN2OS/c12-9-7(14)4-8(15)11(10(9)13)17-5-6-2-1-3-16-6/h4,6H,1-3,5,14-15H2 |
| InChIKey | NYVUCGUGBLLHGG-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.76 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|