C14H21NO2S — CID 106494105
2-(3-methoxyphenyl)-2-(oxolan-2-ylmethylsulfanyl)ethanamine (PubChem CID 106494105) has the molecular formula C14H21NO2S and a molecular weight of 267.39 g/mol. Its IUPAC name is 2-(3-methoxyphenyl)-2-(oxolan-2-ylmethylsulfanyl)ethanamine.
| Compound Name | 2-(3-methoxyphenyl)-2-(oxolan-2-ylmethylsulfanyl)ethanamine |
|---|---|
| PubChem CID | 106494105 |
| Molecular Formula | C14H21NO2S |
| Molecular Weight | 267.39 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 2-(3-methoxyphenyl)-2-(oxolan-2-ylmethylsulfanyl)ethanamine |
| SMILES | COc1cccc(C(CN)SCC2CCCO2)c1 |
| InChI | InChI=1S/C14H21NO2S/c1-16-12-5-2-4-11(8-12)14(9-15)18-10-13-6-3-7-17-13/h2,4-5,8,13-14H,3,6-7,9-10,15H2,1H3 |
| InChIKey | VDRLLQAOGFRWQT-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.39 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |