C12H16ClNO2S — CID 106495314
2-chloro-5-(oxolan-2-ylmethylsulfinylmethyl)aniline (PubChem CID 106495314) has the molecular formula C12H16ClNO2S and a molecular weight of 273.78 g/mol. Its IUPAC name is 2-chloro-5-(oxolan-2-ylmethylsulfinylmethyl)aniline.
| Compound Name | 2-chloro-5-(oxolan-2-ylmethylsulfinylmethyl)aniline |
|---|---|
| PubChem CID | 106495314 |
| Molecular Formula | C12H16ClNO2S |
| Molecular Weight | 273.78 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | 2-chloro-5-(oxolan-2-ylmethylsulfinylmethyl)aniline |
| SMILES | Nc1cc(CS(=O)CC2CCCO2)ccc1Cl |
| InChI | InChI=1S/C12H16ClNO2S/c13-11-4-3-9(6-12(11)14)7-17(15)8-10-2-1-5-16-10/h3-4,6,10H,1-2,5,7-8,14H2 |
| InChIKey | WKOFHUHKIQLWAY-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.78 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|