C13H16F3NO2S — CID 106495284
4-(oxolan-2-ylmethylsulfinylmethyl)-3-(trifluoromethyl)aniline (PubChem CID 106495284) has the molecular formula C13H16F3NO2S and a molecular weight of 307.34 g/mol. Its IUPAC name is 4-(oxolan-2-ylmethylsulfinylmethyl)-3-(trifluoromethyl)aniline.
| Compound Name | 4-(oxolan-2-ylmethylsulfinylmethyl)-3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 106495284 |
| Molecular Formula | C13H16F3NO2S |
| Molecular Weight | 307.34 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | 4-(oxolan-2-ylmethylsulfinylmethyl)-3-(trifluoromethyl)aniline |
| SMILES | Nc1ccc(CS(=O)CC2CCCO2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H16F3NO2S/c14-13(15,16)12-6-10(17)4-3-9(12)7-20(18)8-11-2-1-5-19-11/h3-4,6,11H,1-2,5,7-8,17H2 |
| InChIKey | VBXNYJXEZQHXSC-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.34 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|