C16H20O2S — CID 106495405
4-[3-(oxolan-2-ylmethylsulfanylmethyl)phenyl]but-3-yn-1-ol (PubChem CID 106495405) has the molecular formula C16H20O2S and a molecular weight of 276.40 g/mol. Its IUPAC name is 4-[3-(oxolan-2-ylmethylsulfanylmethyl)phenyl]but-3-yn-1-ol.
| Compound Name | 4-[3-(oxolan-2-ylmethylsulfanylmethyl)phenyl]but-3-yn-1-ol |
|---|---|
| PubChem CID | 106495405 |
| Molecular Formula | C16H20O2S |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 4-[3-(oxolan-2-ylmethylsulfanylmethyl)phenyl]but-3-yn-1-ol |
| SMILES | OCCC#Cc1cccc(CSCC2CCCO2)c1 |
| InChI | InChI=1S/C16H20O2S/c17-9-2-1-5-14-6-3-7-15(11-14)12-19-13-16-8-4-10-18-16/h3,6-7,11,16-17H,2,4,8-10,12-13H2 |
| InChIKey | UAGPFWIVKMBFOA-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|