C17H22O3S — CID 106495400
4-[4-methoxy-2-(oxolan-2-ylmethylsulfanylmethyl)phenyl]but-3-yn-1-ol (PubChem CID 106495400) has the molecular formula C17H22O3S and a molecular weight of 306.43 g/mol. Its IUPAC name is 4-[4-methoxy-2-(oxolan-2-ylmethylsulfanylmethyl)phenyl]but-3-yn-1-ol.
| Compound Name | 4-[4-methoxy-2-(oxolan-2-ylmethylsulfanylmethyl)phenyl]but-3-yn-1-ol |
|---|---|
| PubChem CID | 106495400 |
| Molecular Formula | C17H22O3S |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | 4-[4-methoxy-2-(oxolan-2-ylmethylsulfanylmethyl)phenyl]but-3-yn-1-ol |
| SMILES | COc1ccc(C#CCCO)c(CSCC2CCCO2)c1 |
| InChI | InChI=1S/C17H22O3S/c1-19-16-8-7-14(5-2-3-9-18)15(11-16)12-21-13-17-6-4-10-20-17/h7-8,11,17-18H,3-4,6,9-10,12-13H2,1H3 |
| InChIKey | QHTIXXAUNUNLCD-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|