C12H17N3O3S — CID 106495807
[2-nitro-4-(oxolan-2-ylmethylsulfanylmethyl)phenyl]hydrazine (PubChem CID 106495807) has the molecular formula C12H17N3O3S and a molecular weight of 283.35 g/mol. Its IUPAC name is [2-nitro-4-(oxolan-2-ylmethylsulfanylmethyl)phenyl]hydrazine.
| Compound Name | [2-nitro-4-(oxolan-2-ylmethylsulfanylmethyl)phenyl]hydrazine |
|---|---|
| PubChem CID | 106495807 |
| Molecular Formula | C12H17N3O3S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | [2-nitro-4-(oxolan-2-ylmethylsulfanylmethyl)phenyl]hydrazine |
| SMILES | NNc1ccc(CSCC2CCCO2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H17N3O3S/c13-14-11-4-3-9(6-12(11)15(16)17)7-19-8-10-2-1-5-18-10/h3-4,6,10,14H,1-2,5,7-8,13H2 |
| InChIKey | XOKYAFWCSADOCQ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 90.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|