C14H22N4O3 — CID 62246253
N-[(4-hydrazinyl-3-nitrophenyl)methyl]-N-methyl-1-(oxan-2-yl)methanamine (PubChem CID 62246253) has the molecular formula C14H22N4O3 and a molecular weight of 294.35 g/mol. Its IUPAC name is N-[(4-hydrazinyl-3-nitrophenyl)methyl]-N-methyl-1-(oxan-2-yl)methanamine.
| Compound Name | N-[(4-hydrazinyl-3-nitrophenyl)methyl]-N-methyl-1-(oxan-2-yl)methanamine |
|---|---|
| PubChem CID | 62246253 |
| Molecular Formula | C14H22N4O3 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | N-[(4-hydrazinyl-3-nitrophenyl)methyl]-N-methyl-1-(oxan-2-yl)methanamine |
| SMILES | CN(Cc1ccc(NN)c([N+](=O)[O-])c1)CC1CCCCO1 |
| InChI | InChI=1S/C14H22N4O3/c1-17(10-12-4-2-3-7-21-12)9-11-5-6-13(16-15)14(8-11)18(19)20/h5-6,8,12,16H,2-4,7,9-10,15H2,1H3 |
| InChIKey | WPLKCZUNGLOHQL-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 93.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|