C17H33NO2S — CID 106496357
2-(oxolan-2-ylmethylsulfinyl)-N,4-dipropylcyclohexan-1-amine (PubChem CID 106496357) has the molecular formula C17H33NO2S and a molecular weight of 315.52 g/mol. Its IUPAC name is 2-(oxolan-2-ylmethylsulfinyl)-N,4-dipropylcyclohexan-1-amine.
| Compound Name | 2-(oxolan-2-ylmethylsulfinyl)-N,4-dipropylcyclohexan-1-amine |
|---|---|
| PubChem CID | 106496357 |
| Molecular Formula | C17H33NO2S |
| Molecular Weight | 315.52 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | 2-(oxolan-2-ylmethylsulfinyl)-N,4-dipropylcyclohexan-1-amine |
| SMILES | CCCNC1CCC(CCC)CC1S(=O)CC1CCCO1 |
| InChI | InChI=1S/C17H33NO2S/c1-3-6-14-8-9-16(18-10-4-2)17(12-14)21(19)13-15-7-5-11-20-15/h14-18H,3-13H2,1-2H3 |
| InChIKey | FGANYMXWXIJNRS-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.52 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |