C16H33NOS — CID 64651231
2-(2-methylpropylsulfinyl)-N,4-dipropylcyclohexan-1-amine (PubChem CID 64651231) has the molecular formula C16H33NOS and a molecular weight of 287.51 g/mol. Its IUPAC name is 2-(2-methylpropylsulfinyl)-N,4-dipropylcyclohexan-1-amine.
| Compound Name | 2-(2-methylpropylsulfinyl)-N,4-dipropylcyclohexan-1-amine |
|---|---|
| PubChem CID | 64651231 |
| Molecular Formula | C16H33NOS |
| Molecular Weight | 287.51 g/mol |
| Exact Mass | 287.23 |
| IUPAC Name | 2-(2-methylpropylsulfinyl)-N,4-dipropylcyclohexan-1-amine |
| SMILES | CCCNC1CCC(CCC)CC1S(=O)CC(C)C |
| InChI | InChI=1S/C16H33NOS/c1-5-7-14-8-9-15(17-10-6-2)16(11-14)19(18)12-13(3)4/h13-17H,5-12H2,1-4H3 |
| InChIKey | KUQUXNDFEXLLFL-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.51 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |