C14H29NOS — CID 64651216
N,4-diethyl-2-(2-methylpropylsulfinyl)cyclohexan-1-amine (PubChem CID 64651216) has the molecular formula C14H29NOS and a molecular weight of 259.46 g/mol. Its IUPAC name is N,4-diethyl-2-(2-methylpropylsulfinyl)cyclohexan-1-amine.
| Compound Name | N,4-diethyl-2-(2-methylpropylsulfinyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 64651216 |
| Molecular Formula | C14H29NOS |
| Molecular Weight | 259.46 g/mol |
| Exact Mass | 259.20 |
| IUPAC Name | N,4-diethyl-2-(2-methylpropylsulfinyl)cyclohexan-1-amine |
| SMILES | CCNC1CCC(CC)CC1S(=O)CC(C)C |
| InChI | InChI=1S/C14H29NOS/c1-5-12-7-8-13(15-6-2)14(9-12)17(16)10-11(3)4/h11-15H,5-10H2,1-4H3 |
| InChIKey | QGVRTCYCUKJSNU-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.46 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |