C17H27NOS — CID 64656639
N,4-diethyl-2-(3-methylphenyl)sulfinylcyclohexan-1-amine (PubChem CID 64656639) has the molecular formula C17H27NOS and a molecular weight of 293.48 g/mol. Its IUPAC name is N,4-diethyl-2-(3-methylphenyl)sulfinylcyclohexan-1-amine.
| Compound Name | N,4-diethyl-2-(3-methylphenyl)sulfinylcyclohexan-1-amine |
|---|---|
| PubChem CID | 64656639 |
| Molecular Formula | C17H27NOS |
| Molecular Weight | 293.48 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | N,4-diethyl-2-(3-methylphenyl)sulfinylcyclohexan-1-amine |
| SMILES | CCNC1CCC(CC)CC1S(=O)c1cccc(C)c1 |
| InChI | InChI=1S/C17H27NOS/c1-4-14-9-10-16(18-5-2)17(12-14)20(19)15-8-6-7-13(3)11-15/h6-8,11,14,16-18H,4-5,9-10,12H2,1-3H3 |
| InChIKey | PQZIRVJUKSRCHF-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.48 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |