C17H26BrNOS — CID 64651402
2-(2-bromophenyl)sulfinyl-4-ethyl-N-propylcyclohexan-1-amine (PubChem CID 64651402) has the molecular formula C17H26BrNOS and a molecular weight of 372.37 g/mol. Its IUPAC name is 2-(2-bromophenyl)sulfinyl-4-ethyl-N-propylcyclohexan-1-amine.
| Compound Name | 2-(2-bromophenyl)sulfinyl-4-ethyl-N-propylcyclohexan-1-amine |
|---|---|
| PubChem CID | 64651402 |
| Molecular Formula | C17H26BrNOS |
| Molecular Weight | 372.37 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | 2-(2-bromophenyl)sulfinyl-4-ethyl-N-propylcyclohexan-1-amine |
| SMILES | CCCNC1CCC(CC)CC1S(=O)c1ccccc1Br |
| InChI | InChI=1S/C17H26BrNOS/c1-3-11-19-15-10-9-13(4-2)12-17(15)21(20)16-8-6-5-7-14(16)18/h5-8,13,15,17,19H,3-4,9-12H2,1-2H3 |
| InChIKey | XSBXTASXZATSQP-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.37 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |