C18H37N — CID 82929498
2-(2-ethylbutyl)-N,4-dipropylcyclohexan-1-amine (PubChem CID 82929498) has the molecular formula C18H37N and a molecular weight of 267.50 g/mol. Its IUPAC name is 2-(2-ethylbutyl)-N,4-dipropylcyclohexan-1-amine.
| Compound Name | 2-(2-ethylbutyl)-N,4-dipropylcyclohexan-1-amine |
|---|---|
| PubChem CID | 82929498 |
| Molecular Formula | C18H37N |
| Molecular Weight | 267.50 g/mol |
| Exact Mass | 267.29 |
| IUPAC Name | 2-(2-ethylbutyl)-N,4-dipropylcyclohexan-1-amine |
| SMILES | CCCNC1CCC(CCC)CC1CC(CC)CC |
| InChI | InChI=1S/C18H37N/c1-5-9-16-10-11-18(19-12-6-2)17(14-16)13-15(7-3)8-4/h15-19H,5-14H2,1-4H3 |
| InChIKey | JIOPEFDGWSUSIS-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.50 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |