C18H37NO2 — CID 103410737
2-[3-(2-methoxyethoxy)propyl]-N,4-dipropylcyclohexan-1-amine (PubChem CID 103410737) has the molecular formula C18H37NO2 and a molecular weight of 299.50 g/mol. Its IUPAC name is 2-[3-(2-methoxyethoxy)propyl]-N,4-dipropylcyclohexan-1-amine.
| Compound Name | 2-[3-(2-methoxyethoxy)propyl]-N,4-dipropylcyclohexan-1-amine |
|---|---|
| PubChem CID | 103410737 |
| Molecular Formula | C18H37NO2 |
| Molecular Weight | 299.50 g/mol |
| Exact Mass | 299.28 |
| IUPAC Name | 2-[3-(2-methoxyethoxy)propyl]-N,4-dipropylcyclohexan-1-amine |
| SMILES | CCCNC1CCC(CCC)CC1CCCOCCOC |
| InChI | InChI=1S/C18H37NO2/c1-4-7-16-9-10-18(19-11-5-2)17(15-16)8-6-12-21-14-13-20-3/h16-19H,4-15H2,1-3H3 |
| InChIKey | MXNGXWHONFOOIR-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.50 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|