C17H35NO — CID 65180818
2-(3-ethoxypropyl)-N,4-dipropylcyclohexan-1-amine (PubChem CID 65180818) has the molecular formula C17H35NO and a molecular weight of 269.47 g/mol. Its IUPAC name is 2-(3-ethoxypropyl)-N,4-dipropylcyclohexan-1-amine.
| Compound Name | 2-(3-ethoxypropyl)-N,4-dipropylcyclohexan-1-amine |
|---|---|
| PubChem CID | 65180818 |
| Molecular Formula | C17H35NO |
| Molecular Weight | 269.47 g/mol |
| Exact Mass | 269.27 |
| IUPAC Name | 2-(3-ethoxypropyl)-N,4-dipropylcyclohexan-1-amine |
| SMILES | CCCNC1CCC(CCC)CC1CCCOCC |
| InChI | InChI=1S/C17H35NO/c1-4-8-15-10-11-17(18-12-5-2)16(14-15)9-7-13-19-6-3/h15-18H,4-14H2,1-3H3 |
| InChIKey | GDXSHSKYIRYWFI-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.47 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|