C18H35NOS — CID 106496874
4-tert-butyl-2-(oxolan-2-ylmethylsulfanyl)-N-propylcyclohexan-1-amine (PubChem CID 106496874) has the molecular formula C18H35NOS and a molecular weight of 313.55 g/mol. Its IUPAC name is 4-tert-butyl-2-(oxolan-2-ylmethylsulfanyl)-N-propylcyclohexan-1-amine.
| Compound Name | 4-tert-butyl-2-(oxolan-2-ylmethylsulfanyl)-N-propylcyclohexan-1-amine |
|---|---|
| PubChem CID | 106496874 |
| Molecular Formula | C18H35NOS |
| Molecular Weight | 313.55 g/mol |
| Exact Mass | 313.24 |
| IUPAC Name | 4-tert-butyl-2-(oxolan-2-ylmethylsulfanyl)-N-propylcyclohexan-1-amine |
| SMILES | CCCNC1CCC(C(C)(C)C)CC1SCC1CCCO1 |
| InChI | InChI=1S/C18H35NOS/c1-5-10-19-16-9-8-14(18(2,3)4)12-17(16)21-13-15-7-6-11-20-15/h14-17,19H,5-13H2,1-4H3 |
| InChIKey | XBLZYRAVMORBFY-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.55 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |