C15H31NS — CID 64625882
4-(2-methylbutan-2-yl)-2-methylsulfanyl-N-propylcyclohexan-1-amine (PubChem CID 64625882) has the molecular formula C15H31NS and a molecular weight of 257.49 g/mol. Its IUPAC name is 4-(2-methylbutan-2-yl)-2-methylsulfanyl-N-propylcyclohexan-1-amine.
| Compound Name | 4-(2-methylbutan-2-yl)-2-methylsulfanyl-N-propylcyclohexan-1-amine |
|---|---|
| PubChem CID | 64625882 |
| Molecular Formula | C15H31NS |
| Molecular Weight | 257.49 g/mol |
| Exact Mass | 257.22 |
| IUPAC Name | 4-(2-methylbutan-2-yl)-2-methylsulfanyl-N-propylcyclohexan-1-amine |
| SMILES | CCCNC1CCC(C(C)(C)CC)CC1SC |
| InChI | InChI=1S/C15H31NS/c1-6-10-16-13-9-8-12(11-14(13)17-5)15(3,4)7-2/h12-14,16H,6-11H2,1-5H3 |
| InChIKey | KQXSTYXQZNNXQB-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.49 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |