C15H31NOS — CID 66126855
3-[2-(methylamino)-5-(2-methylbutan-2-yl)cyclohexyl]sulfanylpropan-1-ol (PubChem CID 66126855) has the molecular formula C15H31NOS and a molecular weight of 273.49 g/mol. Its IUPAC name is 3-[2-(methylamino)-5-(2-methylbutan-2-yl)cyclohexyl]sulfanylpropan-1-ol.
| Compound Name | 3-[2-(methylamino)-5-(2-methylbutan-2-yl)cyclohexyl]sulfanylpropan-1-ol |
|---|---|
| PubChem CID | 66126855 |
| Molecular Formula | C15H31NOS |
| Molecular Weight | 273.49 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | 3-[2-(methylamino)-5-(2-methylbutan-2-yl)cyclohexyl]sulfanylpropan-1-ol |
| SMILES | CCC(C)(C)C1CCC(NC)C(SCCCO)C1 |
| InChI | InChI=1S/C15H31NOS/c1-5-15(2,3)12-7-8-13(16-4)14(11-12)18-10-6-9-17/h12-14,16-17H,5-11H2,1-4H3 |
| InChIKey | VFMQZQWRVMYZAK-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.49 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|