C17H35NS — CID 107763602
N-methyl-4-(2-methylbutan-2-yl)-2-(2-methylbutylsulfanyl)cyclohexan-1-amine (PubChem CID 107763602) has the molecular formula C17H35NS and a molecular weight of 285.54 g/mol. Its IUPAC name is N-methyl-4-(2-methylbutan-2-yl)-2-(2-methylbutylsulfanyl)cyclohexan-1-amine.
| Compound Name | N-methyl-4-(2-methylbutan-2-yl)-2-(2-methylbutylsulfanyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 107763602 |
| Molecular Formula | C17H35NS |
| Molecular Weight | 285.54 g/mol |
| Exact Mass | 285.25 |
| IUPAC Name | N-methyl-4-(2-methylbutan-2-yl)-2-(2-methylbutylsulfanyl)cyclohexan-1-amine |
| SMILES | CCC(C)CSC1CC(C(C)(C)CC)CCC1NC |
| InChI | InChI=1S/C17H35NS/c1-7-13(3)12-19-16-11-14(17(4,5)8-2)9-10-15(16)18-6/h13-16,18H,7-12H2,1-6H3 |
| InChIKey | HIWPEVLATQJLIW-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.54 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |