C18H28ClNS — CID 64632525
2-(3-chlorophenyl)sulfanyl-N-methyl-4-(2-methylbutan-2-yl)cyclohexan-1-amine (PubChem CID 64632525) has the molecular formula C18H28ClNS and a molecular weight of 325.95 g/mol. Its IUPAC name is 2-(3-chlorophenyl)sulfanyl-N-methyl-4-(2-methylbutan-2-yl)cyclohexan-1-amine.
| Compound Name | 2-(3-chlorophenyl)sulfanyl-N-methyl-4-(2-methylbutan-2-yl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 64632525 |
| Molecular Formula | C18H28ClNS |
| Molecular Weight | 325.95 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | 2-(3-chlorophenyl)sulfanyl-N-methyl-4-(2-methylbutan-2-yl)cyclohexan-1-amine |
| SMILES | CCC(C)(C)C1CCC(NC)C(Sc2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C18H28ClNS/c1-5-18(2,3)13-9-10-16(20-4)17(11-13)21-15-8-6-7-14(19)12-15/h6-8,12-13,16-17,20H,5,9-11H2,1-4H3 |
| InChIKey | PFSIETGFSADJDW-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.95 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |