C19H27NS — CID 63538943
4-(2-methylbutan-2-yl)-2-(3-methylphenyl)sulfanylcyclohexane-1-carbonitrile (PubChem CID 63538943) has the molecular formula C19H27NS and a molecular weight of 301.50 g/mol. Its IUPAC name is 4-(2-methylbutan-2-yl)-2-(3-methylphenyl)sulfanylcyclohexane-1-carbonitrile.
| Compound Name | 4-(2-methylbutan-2-yl)-2-(3-methylphenyl)sulfanylcyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 63538943 |
| Molecular Formula | C19H27NS |
| Molecular Weight | 301.50 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | 4-(2-methylbutan-2-yl)-2-(3-methylphenyl)sulfanylcyclohexane-1-carbonitrile |
| SMILES | CCC(C)(C)C1CCC(C#N)C(Sc2cccc(C)c2)C1 |
| InChI | InChI=1S/C19H27NS/c1-5-19(3,4)16-10-9-15(13-20)18(12-16)21-17-8-6-7-14(2)11-17/h6-8,11,15-16,18H,5,9-10,12H2,1-4H3 |
| InChIKey | XGRHXMAZAABOOI-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.50 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |