C16H23NO2S2 — CID 64689957
4-(2-methylbutan-2-yl)-2-thiophen-2-ylsulfonylcyclohexane-1-carbonitrile (PubChem CID 64689957) has the molecular formula C16H23NO2S2 and a molecular weight of 325.50 g/mol. Its IUPAC name is 4-(2-methylbutan-2-yl)-2-thiophen-2-ylsulfonylcyclohexane-1-carbonitrile.
| Compound Name | 4-(2-methylbutan-2-yl)-2-thiophen-2-ylsulfonylcyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 64689957 |
| Molecular Formula | C16H23NO2S2 |
| Molecular Weight | 325.50 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 4-(2-methylbutan-2-yl)-2-thiophen-2-ylsulfonylcyclohexane-1-carbonitrile |
| SMILES | CCC(C)(C)C1CCC(C#N)C(S(=O)(=O)c2cccs2)C1 |
| InChI | InChI=1S/C16H23NO2S2/c1-4-16(2,3)13-8-7-12(11-17)14(10-13)21(18,19)15-6-5-9-20-15/h5-6,9,12-14H,4,7-8,10H2,1-3H3 |
| InChIKey | PFVAURNIYZBXEZ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.50 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |