C16H30N2O — CID 55060778
2-[2-hydroxypropyl(methyl)amino]-4-(2-methylbutan-2-yl)cyclohexane-1-carbonitrile (PubChem CID 55060778) has the molecular formula C16H30N2O and a molecular weight of 266.43 g/mol. Its IUPAC name is 2-[2-hydroxypropyl(methyl)amino]-4-(2-methylbutan-2-yl)cyclohexane-1-carbonitrile.
| Compound Name | 2-[2-hydroxypropyl(methyl)amino]-4-(2-methylbutan-2-yl)cyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 55060778 |
| Molecular Formula | C16H30N2O |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.24 |
| IUPAC Name | 2-[2-hydroxypropyl(methyl)amino]-4-(2-methylbutan-2-yl)cyclohexane-1-carbonitrile |
| SMILES | CCC(C)(C)C1CCC(C#N)C(N(C)CC(C)O)C1 |
| InChI | InChI=1S/C16H30N2O/c1-6-16(3,4)14-8-7-13(10-17)15(9-14)18(5)11-12(2)19/h12-15,19H,6-9,11H2,1-5H3 |
| InChIKey | HEKNUIRAWUUWKX-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 47.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |