C14H26N2O — CID 55060731
2-[2-hydroxypropyl(methyl)amino]-4-propylcyclohexane-1-carbonitrile (PubChem CID 55060731) has the molecular formula C14H26N2O and a molecular weight of 238.37 g/mol. Its IUPAC name is 2-[2-hydroxypropyl(methyl)amino]-4-propylcyclohexane-1-carbonitrile.
| Compound Name | 2-[2-hydroxypropyl(methyl)amino]-4-propylcyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 55060731 |
| Molecular Formula | C14H26N2O |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.20 |
| IUPAC Name | 2-[2-hydroxypropyl(methyl)amino]-4-propylcyclohexane-1-carbonitrile |
| SMILES | CCCC1CCC(C#N)C(N(C)CC(C)O)C1 |
| InChI | InChI=1S/C14H26N2O/c1-4-5-12-6-7-13(9-15)14(8-12)16(3)10-11(2)17/h11-14,17H,4-8,10H2,1-3H3 |
| InChIKey | WLEMQCMQRQPWCY-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 47.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |