C19H28N2 — CID 43291824
2-[methyl-[(4-methylphenyl)methyl]amino]-4-propylcyclohexane-1-carbonitrile (PubChem CID 43291824) has the molecular formula C19H28N2 and a molecular weight of 284.45 g/mol. Its IUPAC name is 2-[methyl-[(4-methylphenyl)methyl]amino]-4-propylcyclohexane-1-carbonitrile.
| Compound Name | 2-[methyl-[(4-methylphenyl)methyl]amino]-4-propylcyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 43291824 |
| Molecular Formula | C19H28N2 |
| Molecular Weight | 284.45 g/mol |
| Exact Mass | 284.23 |
| IUPAC Name | 2-[methyl-[(4-methylphenyl)methyl]amino]-4-propylcyclohexane-1-carbonitrile |
| SMILES | CCCC1CCC(C#N)C(N(C)Cc2ccc(C)cc2)C1 |
| InChI | InChI=1S/C19H28N2/c1-4-5-16-10-11-18(13-20)19(12-16)21(3)14-17-8-6-15(2)7-9-17/h6-9,16,18-19H,4-5,10-12,14H2,1-3H3 |
| InChIKey | HLHZRZGOADTIGO-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.45 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |