C16H29NOS — CID 107770648
2-(3-hydroxybutan-2-ylsulfanyl)-4-(2-methylbutan-2-yl)cyclohexane-1-carbonitrile (PubChem CID 107770648) has the molecular formula C16H29NOS and a molecular weight of 283.48 g/mol. Its IUPAC name is 2-(3-hydroxybutan-2-ylsulfanyl)-4-(2-methylbutan-2-yl)cyclohexane-1-carbonitrile.
| Compound Name | 2-(3-hydroxybutan-2-ylsulfanyl)-4-(2-methylbutan-2-yl)cyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 107770648 |
| Molecular Formula | C16H29NOS |
| Molecular Weight | 283.48 g/mol |
| Exact Mass | 283.20 |
| IUPAC Name | 2-(3-hydroxybutan-2-ylsulfanyl)-4-(2-methylbutan-2-yl)cyclohexane-1-carbonitrile |
| SMILES | CCC(C)(C)C1CCC(C#N)C(SC(C)C(C)O)C1 |
| InChI | InChI=1S/C16H29NOS/c1-6-16(4,5)14-8-7-13(10-17)15(9-14)19-12(3)11(2)18/h11-15,18H,6-9H2,1-5H3 |
| InChIKey | HUYCIZWRQUGWEF-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.48 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |