C16H25N3S — CID 43292981
4-(2-methylbutan-2-yl)-2-(1-methylimidazol-2-yl)sulfanylcyclohexane-1-carbonitrile (PubChem CID 43292981) has the molecular formula C16H25N3S and a molecular weight of 291.46 g/mol. Its IUPAC name is 4-(2-methylbutan-2-yl)-2-(1-methylimidazol-2-yl)sulfanylcyclohexane-1-carbonitrile.
| Compound Name | 4-(2-methylbutan-2-yl)-2-(1-methylimidazol-2-yl)sulfanylcyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 43292981 |
| Molecular Formula | C16H25N3S |
| Molecular Weight | 291.46 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | 4-(2-methylbutan-2-yl)-2-(1-methylimidazol-2-yl)sulfanylcyclohexane-1-carbonitrile |
| SMILES | CCC(C)(C)C1CCC(C#N)C(Sc2nccn2C)C1 |
| InChI | InChI=1S/C16H25N3S/c1-5-16(2,3)13-7-6-12(11-17)14(10-13)20-15-18-8-9-19(15)4/h8-9,12-14H,5-7,10H2,1-4H3 |
| InChIKey | PAGUBADCNJILRK-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.46 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |